Indanol

Indanol

Identifiers
CAS Number	1: 6351-10-6 racemic 2: 4254-29-9 4: 1641-41-4 5: 1470-94-6
3D model (JSmol)	1: Interactive image 2: Interactive image 4: Interactive image 5: Interactive image
Beilstein Reference	1:2042960,
ChEBI	1: CHEBI:16697 5: CHEBI:59311
ChEMBL	1: ChEMBL4564909 5: ChEMBL3218378
ChemSpider	1: 21394 2: 70326 4: 66840 5: 14390
EC Number	1: 228-755-3 2: 224-230-8 4: 216-691-9 5: 216-006-3
KEGG	1: C01710
PubChem CID	1: 22819 2: 77936 4: 74233 5: 15118
UNII	1: LHG5BD7LOR 2: B77NA7SM29 4: 7PJT17BE05 5: 9Z94H6F15T
CompTox Dashboard (EPA)	4: DTXSID00167708 5: DTXSID0051732
InChI 1: InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2 Key: YIAPLDFPUUJILH-UHFFFAOYSA-N 2: InChI=1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2 Key: KMGCKSAIIHOKCX-UHFFFAOYSA-N 4: InChI=1S/C9H10O/c10-9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2 Key: DPHNJPUOMLRELT-UHFFFAOYSA-N 5: InChI=1S/C9H10O/c10-9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3H2 Key: PEHSSTUGJUBZBI-UHFFFAOYSA-N
SMILES 1: OC1CCc2ccccc21 2: OC1Cc2ccccc2C1 4: Oc1cccc2c1CCC2 5: Oc1ccc2c(c1)CCC2
Properties
Chemical formula	C9H10O
Molar mass	134.178 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Indanols are a class of organic compounds, some of which are useful in medicine or industry. They are hydroxy derivatives of the parent compound called indane (also known as indan).

Isomers

• 
  1-indanol (racemic), m.p. 54.8; R enantiomer, m.p. 67-68°C
• 
  2-indanol, m.p. 68-69 °C
• 
  4-indanol, m.p. 42 °C
• 
  5-indanol, m.p. 58 °C

Five isomers are possible, two of which are phenols (4- and 5-indanols). Three isomers feature hydroxyl group on the five-membered ring, including an enantiomeric pair of 1-indanol. 1-Indanol can be produced by reduction of 1-indanone. 5-indanol can be prepared by sulfonation of indane, following by base cleavage of the indane-5-sulfonate.